C7H14N2O3S — CID 94061079
N-[(3S)-2-oxoazepan-3-yl]methanesulfonamide (PubChem CID 94061079) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is N-[(3S)-2-oxoazepan-3-yl]methanesulfonamide.
| Compound Name | N-[(3S)-2-oxoazepan-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 94061079 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | N-[(3S)-2-oxoazepan-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C7H14N2O3S/c1-13(11,12)9-6-4-2-3-5-8-7(6)10/h6,9H,2-5H2,1H3,(H,8,10)/t6-/m0/s1 |
| InChIKey | AZGAZQRJOGDUGV-LURJTMIESA-N |
| XLogP | -0.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |