C8H17N3O — CID 83014560
3-(2,2-dimethylhydrazinyl)azepan-2-one (PubChem CID 83014560) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-(2,2-dimethylhydrazinyl)azepan-2-one.
| Compound Name | 3-(2,2-dimethylhydrazinyl)azepan-2-one |
|---|---|
| PubChem CID | 83014560 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 3-(2,2-dimethylhydrazinyl)azepan-2-one |
| SMILES | CN(C)NC1CCCCNC1=O |
| InChI | InChI=1S/C8H17N3O/c1-11(2)10-7-5-3-4-6-9-8(7)12/h7,10H,3-6H2,1-2H3,(H,9,12) |
| InChIKey | ZFZUUXVUIYWJCR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|