C12H12BrCl2NO3S — CID 43652967
4-bromo-2,6-dichloro-N-(4-oxocyclohexyl)benzenesulfonamide (PubChem CID 43652967) has the molecular formula C12H12BrCl2NO3S and a molecular weight of 401.11 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(4-oxocyclohexyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(4-oxocyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43652967 |
| Molecular Formula | C12H12BrCl2NO3S |
| Molecular Weight | 401.11 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(4-oxocyclohexyl)benzenesulfonamide |
| SMILES | O=C1CCC(NS(=O)(=O)c2c(Cl)cc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C12H12BrCl2NO3S/c13-7-5-10(14)12(11(15)6-7)20(18,19)16-8-1-3-9(17)4-2-8/h5-6,8,16H,1-4H2 |
| InChIKey | JSRLQMHZCDJCJB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.11 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |