C12H14BrCl2NO2S — CID 60640000
4-bromo-2,6-dichloro-N-cyclohexylbenzenesulfonamide (PubChem CID 60640000) has the molecular formula C12H14BrCl2NO2S and a molecular weight of 387.13 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-cyclohexylbenzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-cyclohexylbenzenesulfonamide |
|---|---|
| PubChem CID | 60640000 |
| Molecular Formula | C12H14BrCl2NO2S |
| Molecular Weight | 387.13 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-cyclohexylbenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C12H14BrCl2NO2S/c13-8-6-10(14)12(11(15)7-8)19(17,18)16-9-4-2-1-3-5-9/h6-7,9,16H,1-5H2 |
| InChIKey | AKZUFACXLCLDQV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.13 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |