C13H20N4O3S — CID 107327973
4-hydrazinyl-2,6-dimethyl-N-(2-oxopiperidin-3-yl)benzenesulfonamide (PubChem CID 107327973) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-hydrazinyl-2,6-dimethyl-N-(2-oxopiperidin-3-yl)benzenesulfonamide.
| Compound Name | 4-hydrazinyl-2,6-dimethyl-N-(2-oxopiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107327973 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-hydrazinyl-2,6-dimethyl-N-(2-oxopiperidin-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(NN)cc(C)c1S(=O)(=O)NC1CCCNC1=O |
| InChI | InChI=1S/C13H20N4O3S/c1-8-6-10(16-14)7-9(2)12(8)21(19,20)17-11-4-3-5-15-13(11)18/h6-7,11,16-17H,3-5,14H2,1-2H3,(H,15,18) |
| InChIKey | RWXDAMHOLCBGBU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|