C11H14N4O3 — CID 114047149
5-amino-2-[(2-oxopiperidin-3-yl)amino]pyridine-3-carboxylic acid (PubChem CID 114047149) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 5-amino-2-[(2-oxopiperidin-3-yl)amino]pyridine-3-carboxylic acid.
| Compound Name | 5-amino-2-[(2-oxopiperidin-3-yl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114047149 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 5-amino-2-[(2-oxopiperidin-3-yl)amino]pyridine-3-carboxylic acid |
| SMILES | Nc1cnc(NC2CCCNC2=O)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H14N4O3/c12-6-4-7(11(17)18)9(14-5-6)15-8-2-1-3-13-10(8)16/h4-5,8H,1-3,12H2,(H,13,16)(H,14,15)(H,17,18) |
| InChIKey | NUIDDNHSEIDMHZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |