C9H14N6O — CID 80908631
3-[(6-hydrazinylpyrimidin-4-yl)amino]piperidin-2-one (PubChem CID 80908631) has the molecular formula C9H14N6O and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-[(6-hydrazinylpyrimidin-4-yl)amino]piperidin-2-one.
| Compound Name | 3-[(6-hydrazinylpyrimidin-4-yl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 80908631 |
| Molecular Formula | C9H14N6O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3-[(6-hydrazinylpyrimidin-4-yl)amino]piperidin-2-one |
| SMILES | NNc1cc(NC2CCCNC2=O)ncn1 |
| InChI | InChI=1S/C9H14N6O/c10-15-8-4-7(12-5-13-8)14-6-2-1-3-11-9(6)16/h4-6H,1-3,10H2,(H,11,16)(H2,12,13,14,15) |
| InChIKey | JBEMCABQXVDCKV-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|