C11H13BrCl2N2 — CID 106365408
5-bromo-3-chloro-N-[2-(chloromethyl)cyclopentyl]pyridin-2-amine (PubChem CID 106365408) has the molecular formula C11H13BrCl2N2 and a molecular weight of 324.05 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-[2-(chloromethyl)cyclopentyl]pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-[2-(chloromethyl)cyclopentyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106365408 |
| Molecular Formula | C11H13BrCl2N2 |
| Molecular Weight | 324.05 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 5-bromo-3-chloro-N-[2-(chloromethyl)cyclopentyl]pyridin-2-amine |
| SMILES | ClCC1CCCC1Nc1ncc(Br)cc1Cl |
| InChI | InChI=1S/C11H13BrCl2N2/c12-8-4-9(14)11(15-6-8)16-10-3-1-2-7(10)5-13/h4,6-7,10H,1-3,5H2,(H,15,16) |
| InChIKey | FMOYDCOHCADKPK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.05 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|