C15H17BrClN3 — CID 106365685
7-bromo-N-[2-(chloromethyl)cyclohexyl]-1,5-naphthyridin-4-amine (PubChem CID 106365685) has the molecular formula C15H17BrClN3 and a molecular weight of 354.68 g/mol. Its IUPAC name is 7-bromo-N-[2-(chloromethyl)cyclohexyl]-1,5-naphthyridin-4-amine.
| Compound Name | 7-bromo-N-[2-(chloromethyl)cyclohexyl]-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 106365685 |
| Molecular Formula | C15H17BrClN3 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 7-bromo-N-[2-(chloromethyl)cyclohexyl]-1,5-naphthyridin-4-amine |
| SMILES | ClCC1CCCCC1Nc1ccnc2cc(Br)cnc12 |
| InChI | InChI=1S/C15H17BrClN3/c16-11-7-14-15(19-9-11)13(5-6-18-14)20-12-4-2-1-3-10(12)8-17/h5-7,9-10,12H,1-4,8H2,(H,18,20) |
| InChIKey | FZKJTPKRJOPYNW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|