C14H15BrClN3 — CID 106365510
7-bromo-N-[2-(chloromethyl)cyclopentyl]-1,5-naphthyridin-4-amine (PubChem CID 106365510) has the molecular formula C14H15BrClN3 and a molecular weight of 340.65 g/mol. Its IUPAC name is 7-bromo-N-[2-(chloromethyl)cyclopentyl]-1,5-naphthyridin-4-amine.
| Compound Name | 7-bromo-N-[2-(chloromethyl)cyclopentyl]-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 106365510 |
| Molecular Formula | C14H15BrClN3 |
| Molecular Weight | 340.65 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 7-bromo-N-[2-(chloromethyl)cyclopentyl]-1,5-naphthyridin-4-amine |
| SMILES | ClCC1CCCC1Nc1ccnc2cc(Br)cnc12 |
| InChI | InChI=1S/C14H15BrClN3/c15-10-6-13-14(18-8-10)12(4-5-17-13)19-11-3-1-2-9(11)7-16/h4-6,8-9,11H,1-3,7H2,(H,17,19) |
| InChIKey | PIGRWPPFIWUSIZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|