C17H20BN3O5 — CID 177245524
3-nitro-2-(pyridin-4-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 177245524) has the molecular formula C17H20BN3O5 and a molecular weight of 357.18 g/mol. Its IUPAC name is 3-nitro-2-(pyridin-4-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-nitro-2-(pyridin-4-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 177245524 |
| Molecular Formula | C17H20BN3O5 |
| Molecular Weight | 357.18 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-nitro-2-(pyridin-4-ylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2cnc(OCc3ccncc3)c([N+](=O)[O-])c2)OC1(C)C |
| InChI | InChI=1S/C17H20BN3O5/c1-16(2)17(3,4)26-18(25-16)13-9-14(21(22)23)15(20-10-13)24-11-12-5-7-19-8-6-12/h5-10H,11H2,1-4H3 |
| InChIKey | LDUCUPANZDJVLK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|