C14H22BNO5S — CID 58255769
2-methoxy-3-(methylsulfonylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 58255769) has the molecular formula C14H22BNO5S and a molecular weight of 327.21 g/mol. Its IUPAC name is 2-methoxy-3-(methylsulfonylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-methoxy-3-(methylsulfonylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 58255769 |
| Molecular Formula | C14H22BNO5S |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-methoxy-3-(methylsulfonylmethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | COc1ncc(B2OC(C)(C)C(C)(C)O2)cc1CS(C)(=O)=O |
| InChI | InChI=1S/C14H22BNO5S/c1-13(2)14(3,4)21-15(20-13)11-7-10(9-22(6,17)18)12(19-5)16-8-11/h7-8H,9H2,1-6H3 |
| InChIKey | JBJVNRHSFAIGKF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|