C15H25BN2O5S — CID 67981970
2-methoxy-N-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide (PubChem CID 67981970) has the molecular formula C15H25BN2O5S and a molecular weight of 356.25 g/mol. Its IUPAC name is 2-methoxy-N-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 2-methoxy-N-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 67981970 |
| Molecular Formula | C15H25BN2O5S |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-methoxy-N-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-sulfonamide |
| SMILES | COc1ncc(B2OC(C)(C)C(C)(C)O2)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C15H25BN2O5S/c1-10(2)18-24(19,20)12-8-11(9-17-13(12)21-7)16-22-14(3,4)15(5,6)23-16/h8-10,18H,1-7H3 |
| InChIKey | YZYFYIKWHPIOGH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|