About 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide
5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide (PubChem CID 71131413) has the molecular formula C13H21BrN2O3S
and a molecular weight of 365.29 g/mol. Its IUPAC name is 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide |
| PubChem CID | 71131413 |
| Molecular Formula | C13H21BrN2O3S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide |
| SMILES | COc1ncc(Br)cc1S(=O)(=O)NC(C(C)C)C(C)C |
| InChI | InChI=1S/C13H21BrN2O3S/c1-8(2)12(9(3)4)16-20(17,18)11-6-10(14)7-15-13(11)19-5/h6-9,12,16H,1-5H3 |
| InChIKey | BAILJBHUQYBEBZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide?
The IUPAC name of 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide (CID 71131413) is 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide.
What is the SMILES notation for 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide?
The canonical SMILES for 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide is COc1ncc(Br)cc1S(=O)(=O)NC(C(C)C)C(C)C.
What is the InChIKey of 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide?
The InChIKey is BAILJBHUQYBEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21BrN2O3S/c1-8(2)12(9(3)4)16-20(17,18)11-6-10(14)7-15-13(11)19-5/h6-9,12,16H,1-5H3.
What are the key properties of 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide?
5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide has a molecular weight of 365.29 g/mol, XLogP of 2.81, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,4-dimethylpentan-3-yl)-2-methoxypyridine-3-sulfonamide is sourced from PubChem (CID 71131413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).