C13H19BrN2O3S — CID 160805742
5-bromo-2-methoxy-N-(4-methylcyclohexyl)pyridine-3-sulfonamide (PubChem CID 160805742) has the molecular formula C13H19BrN2O3S and a molecular weight of 363.28 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-(4-methylcyclohexyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-(4-methylcyclohexyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 160805742 |
| Molecular Formula | C13H19BrN2O3S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 5-bromo-2-methoxy-N-(4-methylcyclohexyl)pyridine-3-sulfonamide |
| SMILES | COc1ncc(Br)cc1S(=O)(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C13H19BrN2O3S/c1-9-3-5-11(6-4-9)16-20(17,18)12-7-10(14)8-15-13(12)19-2/h7-9,11,16H,3-6H2,1-2H3 |
| InChIKey | OSNKFCPVIDQGNH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |