C11H18BrN3O2S — CID 115748656
2-amino-5-bromo-N-(3,3-dimethylbutan-2-yl)pyridine-3-sulfonamide (PubChem CID 115748656) has the molecular formula C11H18BrN3O2S and a molecular weight of 336.26 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(3,3-dimethylbutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-bromo-N-(3,3-dimethylbutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115748656 |
| Molecular Formula | C11H18BrN3O2S |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-amino-5-bromo-N-(3,3-dimethylbutan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(Br)cnc1N)C(C)(C)C |
| InChI | InChI=1S/C11H18BrN3O2S/c1-7(11(2,3)4)15-18(16,17)9-5-8(12)6-14-10(9)13/h5-7,15H,1-4H3,(H2,13,14) |
| InChIKey | BDABSLLXKTZRSU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |