C9H11BrF3N3O2S — CID 104854801
2-amino-5-bromo-N-(4,4,4-trifluorobutan-2-yl)pyridine-3-sulfonamide (PubChem CID 104854801) has the molecular formula C9H11BrF3N3O2S and a molecular weight of 362.17 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(4,4,4-trifluorobutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-bromo-N-(4,4,4-trifluorobutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 104854801 |
| Molecular Formula | C9H11BrF3N3O2S |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 2-amino-5-bromo-N-(4,4,4-trifluorobutan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(CC(F)(F)F)NS(=O)(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C9H11BrF3N3O2S/c1-5(3-9(11,12)13)16-19(17,18)7-2-6(10)4-15-8(7)14/h2,4-5,16H,3H2,1H3,(H2,14,15) |
| InChIKey | SLXJVWDRFIRDKJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |