C19H25BN2O6S — CID 90102129
N-[2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-4-hydroxybenzenesulfonamide (PubChem CID 90102129) has the molecular formula C19H25BN2O6S and a molecular weight of 420.30 g/mol. Its IUPAC name is N-[2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-4-hydroxybenzenesulfonamide.
| Compound Name | N-[2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-4-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 90102129 |
| Molecular Formula | C19H25BN2O6S |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]-4-hydroxybenzenesulfonamide |
| SMILES | CCOc1ncc(B2OC(C)(C)C(C)(C)O2)cc1NS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H25BN2O6S/c1-6-26-17-16(22-29(24,25)15-9-7-14(23)8-10-15)11-13(12-21-17)20-27-18(2,3)19(4,5)28-20/h7-12,22-23H,6H2,1-5H3 |
| InChIKey | LZVAMDPJKMFMNJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|