C20H29BN2O4 — CID 168997116
1-(3-ethyl-3-hydroxycyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1,8-naphthyridin-2-one (PubChem CID 168997116) has the molecular formula C20H29BN2O4 and a molecular weight of 372.27 g/mol. Its IUPAC name is 1-(3-ethyl-3-hydroxycyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1,8-naphthyridin-2-one.
| Compound Name | 1-(3-ethyl-3-hydroxycyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 168997116 |
| Molecular Formula | C20H29BN2O4 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-(3-ethyl-3-hydroxycyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1,8-naphthyridin-2-one |
| SMILES | CCC1(O)CC(N2C(=O)CCc3cc(B4OC(C)(C)C(C)(C)O4)cnc32)C1 |
| InChI | InChI=1S/C20H29BN2O4/c1-6-20(25)10-15(11-20)23-16(24)8-7-13-9-14(12-22-17(13)23)21-26-18(2,3)19(4,5)27-21/h9,12,15,25H,6-8,10-11H2,1-5H3 |
| InChIKey | WQODFCPAAHNYTG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|