C19H26N2O3 — CID 170121840
6-butoxy-1-(3-cyclopropyl-3-hydroxycyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one (PubChem CID 170121840) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 6-butoxy-1-(3-cyclopropyl-3-hydroxycyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one.
| Compound Name | 6-butoxy-1-(3-cyclopropyl-3-hydroxycyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 170121840 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 6-butoxy-1-(3-cyclopropyl-3-hydroxycyclobutyl)-3,4-dihydro-1,8-naphthyridin-2-one |
| SMILES | CCCCOc1cnc2c(c1)CCC(=O)N2C1CC(O)(C2CC2)C1 |
| InChI | InChI=1S/C19H26N2O3/c1-2-3-8-24-16-9-13-4-7-17(22)21(18(13)20-12-16)15-10-19(23,11-15)14-5-6-14/h9,12,14-15,23H,2-8,10-11H2,1H3 |
| InChIKey | SBXJNXRAAXIASD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|