C15H20N4O2 — CID 168996364
1-(3-butoxypyrido[2,3-d]pyridazin-8-yl)-3-methylazetidin-3-ol (PubChem CID 168996364) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-(3-butoxypyrido[2,3-d]pyridazin-8-yl)-3-methylazetidin-3-ol.
| Compound Name | 1-(3-butoxypyrido[2,3-d]pyridazin-8-yl)-3-methylazetidin-3-ol |
|---|---|
| PubChem CID | 168996364 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-(3-butoxypyrido[2,3-d]pyridazin-8-yl)-3-methylazetidin-3-ol |
| SMILES | CCCCOc1cnc2c(N3CC(C)(O)C3)nncc2c1 |
| InChI | InChI=1S/C15H20N4O2/c1-3-4-5-21-12-6-11-7-17-18-14(13(11)16-8-12)19-9-15(2,20)10-19/h6-8,20H,3-5,9-10H2,1-2H3 |
| InChIKey | MSKSUVGIBRKKJR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|