C20H32N2O2 — CID 168997905
ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol (PubChem CID 168997905) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol.
| Compound Name | ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 168997905 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol |
| SMILES | CC.CC.CCCOc1cnc2c(C3CC(C)(O)C3)nccc2c1 |
| InChI | InChI=1S/C16H20N2O2.2C2H6/c1-3-6-20-13-7-11-4-5-17-15(14(11)18-10-13)12-8-16(2,19)9-12;2*1-2/h4-5,7,10,12,19H,3,6,8-9H2,1-2H3;2*1-2H3 |
| InChIKey | VRTVYCORSBXAOI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |