About ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol
ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol (PubChem CID 168997905) has the molecular formula C20H32N2O2
and a molecular weight of 332.49 g/mol. Its IUPAC name is ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol.
Molecular Properties
| Compound Name | ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol |
| PubChem CID | 168997905 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol |
| SMILES | CC.CC.CCCOc1cnc2c(C3CC(C)(O)C3)nccc2c1 |
| InChI | InChI=1S/C16H20N2O2.2C2H6/c1-3-6-20-13-7-11-4-5-17-15(14(11)18-10-13)12-8-16(2,19)9-12;2*1-2/h4-5,7,10,12,19H,3,6,8-9H2,1-2H3;2*1-2H3 |
| InChIKey | VRTVYCORSBXAOI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol?
The IUPAC name of ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol (CID 168997905) is ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol.
What is the SMILES notation for ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol?
The canonical SMILES for ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol is CC.CC.CCCOc1cnc2c(C3CC(C)(O)C3)nccc2c1.
What is the InChIKey of ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol?
The InChIKey is VRTVYCORSBXAOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2.2C2H6/c1-3-6-20-13-7-11-4-5-17-15(14(11)18-10-13)12-8-16(2,19)9-12;2*1-2/h4-5,7,10,12,19H,3,6,8-9H2,1-2H3;2*1-2H3.
What are the key properties of ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol?
ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol has a molecular weight of 332.49 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-3-(3-propoxy-1,7-naphthyridin-8-yl)cyclobutan-1-ol is sourced from PubChem (CID 168997905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).