C13H16BrN3O3 — CID 169031004
6-(2-bromoethoxy)-3-(3-hydroxy-3-methylcyclobutyl)-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 169031004) has the molecular formula C13H16BrN3O3 and a molecular weight of 342.19 g/mol. Its IUPAC name is 6-(2-bromoethoxy)-3-(3-hydroxy-3-methylcyclobutyl)-1H-imidazo[4,5-b]pyridin-2-one.
| Compound Name | 6-(2-bromoethoxy)-3-(3-hydroxy-3-methylcyclobutyl)-1H-imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 169031004 |
| Molecular Formula | C13H16BrN3O3 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 6-(2-bromoethoxy)-3-(3-hydroxy-3-methylcyclobutyl)-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | CC1(O)CC(n2c(=O)[nH]c3cc(OCCBr)cnc32)C1 |
| InChI | InChI=1S/C13H16BrN3O3/c1-13(19)5-8(6-13)17-11-10(16-12(17)18)4-9(7-15-11)20-3-2-14/h4,7-8,19H,2-3,5-6H2,1H3,(H,16,18) |
| InChIKey | AXADDWWCLGQRBJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|