C16H23NOS — CID 143262506
4-[(4-butoxyphenyl)methyl]-2,4-dimethyl-5H-1,3-thiazole (PubChem CID 143262506) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 4-[(4-butoxyphenyl)methyl]-2,4-dimethyl-5H-1,3-thiazole.
| Compound Name | 4-[(4-butoxyphenyl)methyl]-2,4-dimethyl-5H-1,3-thiazole |
|---|---|
| PubChem CID | 143262506 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4-[(4-butoxyphenyl)methyl]-2,4-dimethyl-5H-1,3-thiazole |
| SMILES | CCCCOc1ccc(CC2(C)CSC(C)=N2)cc1 |
| InChI | InChI=1S/C16H23NOS/c1-4-5-10-18-15-8-6-14(7-9-15)11-16(3)12-19-13(2)17-16/h6-9H,4-5,10-12H2,1-3H3 |
| InChIKey | JJEMXWVRAYQXCG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|