C28H34BClN2O4 — CID 170854722
ethyl 4-[13-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene]piperidine-1-carboxylate (PubChem CID 170854722) has the molecular formula C28H34BClN2O4 and a molecular weight of 508.86 g/mol. Its IUPAC name is ethyl 4-[13-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[13-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170854722 |
| Molecular Formula | C28H34BClN2O4 |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | ethyl 4-[13-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cc(B4OC(C)(C)C(C)(C)O4)cnc32)CC1 |
| InChI | InChI=1S/C28H34BClN2O4/c1-6-34-26(33)32-13-11-18(12-14-32)24-23-10-9-22(30)16-19(23)7-8-20-15-21(17-31-25(20)24)29-35-27(2,3)28(4,5)36-29/h9-10,15-17H,6-8,11-14H2,1-5H3 |
| InChIKey | ULHPKEYRTOIPMH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|