C21H20ClIN2O — CID 18715383
1-[4-(13-chloro-6-iodo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone (PubChem CID 18715383) has the molecular formula C21H20ClIN2O and a molecular weight of 478.76 g/mol. Its IUPAC name is 1-[4-(13-chloro-6-iodo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(13-chloro-6-iodo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 18715383 |
| Molecular Formula | C21H20ClIN2O |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 1-[4-(13-chloro-6-iodo-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cc(I)cnc32)CC1 |
| InChI | InChI=1S/C21H20ClIN2O/c1-13(26)25-8-6-14(7-9-25)20-19-5-4-17(22)10-15(19)2-3-16-11-18(23)12-24-21(16)20/h4-5,10-12H,2-3,6-9H2,1H3 |
| InChIKey | NUVLXRSMEGJXEF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|