C15H23BN2O3 — CID 76850018
N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propanamide (PubChem CID 76850018) has the molecular formula C15H23BN2O3 and a molecular weight of 290.17 g/mol. Its IUPAC name is N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propanamide.
| Compound Name | N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 76850018 |
| Molecular Formula | C15H23BN2O3 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]propanamide |
| SMILES | CCC(=O)Nc1ncc(B2OC(C)(C)C(C)(C)O2)cc1C |
| InChI | InChI=1S/C15H23BN2O3/c1-7-12(19)18-13-10(2)8-11(9-17-13)16-20-14(3,4)15(5,6)21-16/h8-9H,7H2,1-6H3,(H,17,18,19) |
| InChIKey | HXJXJYRPVNWCMH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|