C15H21BN2O3 — CID 123663894
N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]prop-2-enamide (PubChem CID 123663894) has the molecular formula C15H21BN2O3 and a molecular weight of 288.16 g/mol. Its IUPAC name is N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 123663894 |
| Molecular Formula | C15H21BN2O3 |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(B2OC(C)(C)C(C)(C)O2)cnc1C |
| InChI | InChI=1S/C15H21BN2O3/c1-7-13(19)18-12-8-11(9-17-10(12)2)16-20-14(3,4)15(5,6)21-16/h7-9H,1H2,2-6H3,(H,18,19) |
| InChIKey | OOBOOIIYYPSWJW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|