C13H19BN2O4 — CID 151401454
[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamic acid (PubChem CID 151401454) has the molecular formula C13H19BN2O4 and a molecular weight of 278.12 g/mol. Its IUPAC name is [4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamic acid.
| Compound Name | [4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 151401454 |
| Molecular Formula | C13H19BN2O4 |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamic acid |
| SMILES | Cc1cc(NC(=O)O)ncc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H19BN2O4/c1-8-6-10(16-11(17)18)15-7-9(8)14-19-12(2,3)13(4,5)20-14/h6-7H,1-5H3,(H,15,16)(H,17,18) |
| InChIKey | OWOOFKMKHVPKGV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|