C21H36BNO7 — CID 163375726
2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 163375726) has the molecular formula C21H36BNO7 and a molecular weight of 425.33 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 163375726 |
| Molecular Formula | C21H36BNO7 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | COCCOCCOCCOCCOc1cc(C)c(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C21H36BNO7/c1-17-15-19(23-16-18(17)22-29-20(2,3)21(4,5)30-22)28-14-13-27-12-11-26-10-9-25-8-7-24-6/h15-16H,7-14H2,1-6H3 |
| InChIKey | NHANGXMQTDHJES-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|