C22H39BO6 — CID 142513343
ethane;2-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 142513343) has the molecular formula C22H39BO6 and a molecular weight of 410.36 g/mol. Its IUPAC name is ethane;2-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | ethane;2-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142513343 |
| Molecular Formula | C22H39BO6 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | ethane;2-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC.COCCOCCOCCOc1ccc(B2OC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C20H33BO6.C2H6/c1-16-15-17(25-14-13-24-12-11-23-10-9-22-6)7-8-18(16)21-26-19(2,3)20(4,5)27-21;1-2/h7-8,15H,9-14H2,1-6H3;1-2H3 |
| InChIKey | HZMLIPGLROQICP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|