C15H24BN3O3 — CID 59619673
N-ethyl-2-(methylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide (PubChem CID 59619673) has the molecular formula C15H24BN3O3 and a molecular weight of 305.19 g/mol. Its IUPAC name is N-ethyl-2-(methylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide.
| Compound Name | N-ethyl-2-(methylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59619673 |
| Molecular Formula | C15H24BN3O3 |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-ethyl-2-(methylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
| SMILES | CCNC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cnc1NC |
| InChI | InChI=1S/C15H24BN3O3/c1-7-18-13(20)11-8-10(9-19-12(11)17-6)16-21-14(2,3)15(4,5)22-16/h8-9H,7H2,1-6H3,(H,17,19)(H,18,20) |
| InChIKey | HDDJTLANDLOFAK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|