C21H34BNO4Si — CID 169114168
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)-3,4-dihydroquinolin-2-one (PubChem CID 169114168) has the molecular formula C21H34BNO4Si and a molecular weight of 403.40 g/mol. Its IUPAC name is 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 169114168 |
| Molecular Formula | C21H34BNO4Si |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2-trimethylsilylethoxymethyl)-3,4-dihydroquinolin-2-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)CCC(=O)N3COCC[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C21H34BNO4Si/c1-20(2)21(3,4)27-22(26-20)17-9-10-18-16(14-17)8-11-19(24)23(18)15-25-12-13-28(5,6)7/h9-10,14H,8,11-13,15H2,1-7H3 |
| InChIKey | IRWXMELVJSABSJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|