C18H26N2O5Si — CID 176705952
3-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]-4-methoxybenzaldehyde (PubChem CID 176705952) has the molecular formula C18H26N2O5Si and a molecular weight of 378.50 g/mol. Its IUPAC name is 3-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]-4-methoxybenzaldehyde.
| Compound Name | 3-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 176705952 |
| Molecular Formula | C18H26N2O5Si |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1N1CCC(=O)N(COCC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C18H26N2O5Si/c1-24-16-6-5-14(12-21)11-15(16)19-8-7-17(22)20(18(19)23)13-25-9-10-26(2,3)4/h5-6,11-12H,7-10,13H2,1-4H3 |
| InChIKey | FWMKUDWVDYNFOP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|