C16H18IN3O6 — CID 175998248
4-[[3-(5-iodo-2-methoxyphenyl)-2,6-dioxo-1,3-diazinan-1-yl]methylamino]-4-oxobutanoic acid (PubChem CID 175998248) has the molecular formula C16H18IN3O6 and a molecular weight of 475.24 g/mol. Its IUPAC name is 4-[[3-(5-iodo-2-methoxyphenyl)-2,6-dioxo-1,3-diazinan-1-yl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-(5-iodo-2-methoxyphenyl)-2,6-dioxo-1,3-diazinan-1-yl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175998248 |
| Molecular Formula | C16H18IN3O6 |
| Molecular Weight | 475.24 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 4-[[3-(5-iodo-2-methoxyphenyl)-2,6-dioxo-1,3-diazinan-1-yl]methylamino]-4-oxobutanoic acid |
| SMILES | COc1ccc(I)cc1N1CCC(=O)N(CNC(=O)CCC(=O)O)C1=O |
| InChI | InChI=1S/C16H18IN3O6/c1-26-12-3-2-10(17)8-11(12)19-7-6-14(22)20(16(19)25)9-18-13(21)4-5-15(23)24/h2-3,8H,4-7,9H2,1H3,(H,18,21)(H,23,24) |
| InChIKey | HTSUCXJJCHISAS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|