C17H21N3O7 — CID 171800273
3-[2-[[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]amino]ethoxy]propanoic acid (PubChem CID 171800273) has the molecular formula C17H21N3O7 and a molecular weight of 379.37 g/mol. Its IUPAC name is 3-[2-[[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]amino]ethoxy]propanoic acid.
| Compound Name | 3-[2-[[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]amino]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 171800273 |
| Molecular Formula | C17H21N3O7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3-[2-[[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methoxybenzoyl]amino]ethoxy]propanoic acid |
| SMILES | COc1ccc(C(=O)NCCOCCC(=O)O)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H21N3O7/c1-26-13-3-2-11(16(24)18-6-9-27-8-5-15(22)23)10-12(13)20-7-4-14(21)19-17(20)25/h2-3,10H,4-9H2,1H3,(H,18,24)(H,22,23)(H,19,21,25) |
| InChIKey | KQGSLKGGCPXREY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|