C12H12N2O4 — CID 62023908
3-[(2,5-dioxoimidazolidin-1-yl)methyl]-4-methoxybenzaldehyde (PubChem CID 62023908) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-4-methoxybenzaldehyde.
| Compound Name | 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 62023908 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C12H12N2O4/c1-18-10-3-2-8(7-15)4-9(10)6-14-11(16)5-13-12(14)17/h2-4,7H,5-6H2,1H3,(H,13,17) |
| InChIKey | QLEOWBHEVCVOFN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|