C12H12N2O5 — CID 62023502
3-[(2,5-dioxoimidazolidin-1-yl)methyl]-4-methoxybenzoic acid (PubChem CID 62023502) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-4-methoxybenzoic acid.
| Compound Name | 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 62023502 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-[(2,5-dioxoimidazolidin-1-yl)methyl]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C12H12N2O5/c1-19-9-3-2-7(11(16)17)4-8(9)6-14-10(15)5-13-12(14)18/h2-4H,5-6H2,1H3,(H,13,18)(H,16,17) |
| InChIKey | DGUVFYXKGCYIAG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|