C26H40N6O5Si — CID 169195368
tert-butyl 4-[4-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]pyrazolo[3,4-c]pyridin-1-yl]piperidine-1-carboxylate (PubChem CID 169195368) has the molecular formula C26H40N6O5Si and a molecular weight of 544.73 g/mol. Its IUPAC name is tert-butyl 4-[4-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]pyrazolo[3,4-c]pyridin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]pyrazolo[3,4-c]pyridin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169195368 |
| Molecular Formula | C26H40N6O5Si |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | tert-butyl 4-[4-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]pyrazolo[3,4-c]pyridin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2ncc3c(N4CCC(=O)N(COCC[Si](C)(C)C)C4=O)cncc32)CC1 |
| InChI | InChI=1S/C26H40N6O5Si/c1-26(2,3)37-25(35)29-10-7-19(8-11-29)32-22-17-27-16-21(20(22)15-28-32)30-12-9-23(33)31(24(30)34)18-36-13-14-38(4,5)6/h15-17,19H,7-14,18H2,1-6H3 |
| InChIKey | QBMOKPJNWDACHY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 110.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|