C15H24BrN3O2 — CID 118961780
tert-butyl 4-(4-bromo-5-ethylpyrazol-1-yl)piperidine-1-carboxylate (PubChem CID 118961780) has the molecular formula C15H24BrN3O2 and a molecular weight of 358.28 g/mol. Its IUPAC name is tert-butyl 4-(4-bromo-5-ethylpyrazol-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-bromo-5-ethylpyrazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118961780 |
| Molecular Formula | C15H24BrN3O2 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | tert-butyl 4-(4-bromo-5-ethylpyrazol-1-yl)piperidine-1-carboxylate |
| SMILES | CCc1c(Br)cnn1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H24BrN3O2/c1-5-13-12(16)10-17-19(13)11-6-8-18(9-7-11)14(20)21-15(2,3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | IXMBMJWUMPSATE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |