C28H34N4O2 — CID 118961816
tert-butyl 4-[4-(benzhydrylideneamino)-5-ethylpyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 118961816) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is tert-butyl 4-[4-(benzhydrylideneamino)-5-ethylpyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(benzhydrylideneamino)-5-ethylpyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118961816 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | tert-butyl 4-[4-(benzhydrylideneamino)-5-ethylpyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CCc1c(N=C(c2ccccc2)c2ccccc2)cnn1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C28H34N4O2/c1-5-25-24(30-26(21-12-8-6-9-13-21)22-14-10-7-11-15-22)20-29-32(25)23-16-18-31(19-17-23)27(33)34-28(2,3)4/h6-15,20,23H,5,16-19H2,1-4H3 |
| InChIKey | PCJFYMGALLHVHC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|