C34H45N5O6Si — CID 169195066
benzyl 4-[6-(dimethylcarbamoyl)-4-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]indol-1-yl]piperidine-1-carboxylate (PubChem CID 169195066) has the molecular formula C34H45N5O6Si and a molecular weight of 647.85 g/mol. Its IUPAC name is benzyl 4-[6-(dimethylcarbamoyl)-4-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]indol-1-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[6-(dimethylcarbamoyl)-4-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]indol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169195066 |
| Molecular Formula | C34H45N5O6Si |
| Molecular Weight | 647.85 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | benzyl 4-[6-(dimethylcarbamoyl)-4-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazinan-1-yl]indol-1-yl]piperidine-1-carboxylate |
| SMILES | CN(C)C(=O)c1cc(N2CCC(=O)N(COCC[Si](C)(C)C)C2=O)c2ccn(C3CCN(C(=O)OCc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C34H45N5O6Si/c1-35(2)32(41)26-21-29-28(30(22-26)38-18-14-31(40)39(33(38)42)24-44-19-20-46(3,4)5)13-17-37(29)27-11-15-36(16-12-27)34(43)45-23-25-9-7-6-8-10-25/h6-10,13,17,21-22,27H,11-12,14-16,18-20,23-24H2,1-5H3 |
| InChIKey | QNXUWYDQAOXEIK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 104.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.85 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|