C27H36N2O4Si — CID 71744038
benzyl 4-[5-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3H-indol-1-yl]piperidine-1-carboxylate (PubChem CID 71744038) has the molecular formula C27H36N2O4Si and a molecular weight of 480.68 g/mol. Its IUPAC name is benzyl 4-[5-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3H-indol-1-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[5-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3H-indol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71744038 |
| Molecular Formula | C27H36N2O4Si |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | benzyl 4-[5-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3H-indol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CC(=O)N2C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H36N2O4Si/c1-27(2,3)34(4,5)33-23-11-12-24-21(17-23)18-25(30)29(24)22-13-15-28(16-14-22)26(31)32-19-20-9-7-6-8-10-20/h6-12,17,22H,13-16,18-19H2,1-5H3 |
| InChIKey | KKXVATMRFMMFDW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|