C24H35N3O5SSi — CID 155632593
benzyl 4-[[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]sulfamoyl]piperidine-1-carboxylate (PubChem CID 155632593) has the molecular formula C24H35N3O5SSi and a molecular weight of 505.71 g/mol. Its IUPAC name is benzyl 4-[[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]sulfamoyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]sulfamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155632593 |
| Molecular Formula | C24H35N3O5SSi |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | benzyl 4-[[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]sulfamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NS(=O)(=O)C2CCN(C(=O)OCc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C24H35N3O5SSi/c1-24(2,3)34(4,5)32-20-11-12-22(25-17-20)26-33(29,30)21-13-15-27(16-14-21)23(28)31-18-19-9-7-6-8-10-19/h6-12,17,21H,13-16,18H2,1-5H3,(H,25,26) |
| InChIKey | IFKLVEJZLQXMFL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|