C30H39N5O5Si — CID 165134099
benzyl N-[[5-cyclopropyl-7-(3-methyl-2,4-dioxoimidazolidin-1-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-N-methylcarbamate (PubChem CID 165134099) has the molecular formula C30H39N5O5Si and a molecular weight of 577.76 g/mol. Its IUPAC name is benzyl N-[[5-cyclopropyl-7-(3-methyl-2,4-dioxoimidazolidin-1-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-N-methylcarbamate.
| Compound Name | benzyl N-[[5-cyclopropyl-7-(3-methyl-2,4-dioxoimidazolidin-1-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 165134099 |
| Molecular Formula | C30H39N5O5Si |
| Molecular Weight | 577.76 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | benzyl N-[[5-cyclopropyl-7-(3-methyl-2,4-dioxoimidazolidin-1-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1nc2cc(C3CC3)cc(N3CC(=O)N(C)C3=O)c2n1COCC[Si](C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H39N5O5Si/c1-32(30(38)40-19-21-9-7-6-8-10-21)17-26-31-24-15-23(22-11-12-22)16-25(34-18-27(36)33(2)29(34)37)28(24)35(26)20-39-13-14-41(3,4)5/h6-10,15-16,22H,11-14,17-20H2,1-5H3 |
| InChIKey | UAHUJDBRRNTPGJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 97.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.76 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|