C24H32N6O3Si — CID 156752220
benzyl N-[[5-(2-azidoethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]carbamate (PubChem CID 156752220) has the molecular formula C24H32N6O3Si and a molecular weight of 480.65 g/mol. Its IUPAC name is benzyl N-[[5-(2-azidoethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[5-(2-azidoethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 156752220 |
| Molecular Formula | C24H32N6O3Si |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | benzyl N-[[5-(2-azidoethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]carbamate |
| SMILES | C[Si](C)(C)CCOCn1c(CNC(=O)OCc2ccccc2)nc2cc(CCN=[N+]=[N-])ccc21 |
| InChI | InChI=1S/C24H32N6O3Si/c1-34(2,3)14-13-32-18-30-22-10-9-19(11-12-27-29-25)15-21(22)28-23(30)16-26-24(31)33-17-20-7-5-4-6-8-20/h4-10,15H,11-14,16-18H2,1-3H3,(H,26,31) |
| InChIKey | UHWITTHYIPGPGR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|