C25H35N3O6SSi — CID 156752270
2-[2-(phenylmethoxycarbonylaminomethyl)-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl methanesulfonate (PubChem CID 156752270) has the molecular formula C25H35N3O6SSi and a molecular weight of 533.72 g/mol. Its IUPAC name is 2-[2-(phenylmethoxycarbonylaminomethyl)-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl methanesulfonate.
| Compound Name | 2-[2-(phenylmethoxycarbonylaminomethyl)-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 156752270 |
| Molecular Formula | C25H35N3O6SSi |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 2-[2-(phenylmethoxycarbonylaminomethyl)-3-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]ethyl methanesulfonate |
| SMILES | C[Si](C)(C)CCOCn1c(CNC(=O)OCc2ccccc2)nc2ccc(CCOS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C25H35N3O6SSi/c1-35(30,31)34-13-12-20-10-11-22-23(16-20)28(19-32-14-15-36(2,3)4)24(27-22)17-26-25(29)33-18-21-8-6-5-7-9-21/h5-11,16H,12-15,17-19H2,1-4H3,(H,26,29) |
| InChIKey | QFCMUXCWSMCKML-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|