C18H27F3N2O2Si — CID 86705759
4-[5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]butan-1-ol (PubChem CID 86705759) has the molecular formula C18H27F3N2O2Si and a molecular weight of 388.51 g/mol. Its IUPAC name is 4-[5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]butan-1-ol.
| Compound Name | 4-[5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 86705759 |
| Molecular Formula | C18H27F3N2O2Si |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-[5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]butan-1-ol |
| SMILES | C[Si](C)(C)CCOCn1c(CCCCO)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H27F3N2O2Si/c1-26(2,3)11-10-25-13-23-16-8-7-14(18(19,20)21)12-15(16)22-17(23)6-4-5-9-24/h7-8,12,24H,4-6,9-11,13H2,1-3H3 |
| InChIKey | KPMWGHKWEHQJMZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|