C11H11F3N3O- — CID 158004110
[1-(2-methoxyethyl)-5-(trifluoromethyl)benzimidazol-2-yl]azanide (PubChem CID 158004110) has the molecular formula C11H11F3N3O- and a molecular weight of 258.22 g/mol. Its IUPAC name is [1-(2-methoxyethyl)-5-(trifluoromethyl)benzimidazol-2-yl]azanide.
| Compound Name | [1-(2-methoxyethyl)-5-(trifluoromethyl)benzimidazol-2-yl]azanide |
|---|---|
| PubChem CID | 158004110 |
| Molecular Formula | C11H11F3N3O- |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [1-(2-methoxyethyl)-5-(trifluoromethyl)benzimidazol-2-yl]azanide |
| SMILES | COCCn1c([NH-])nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C11H11F3N3O/c1-18-5-4-17-9-3-2-7(11(12,13)14)6-8(9)16-10(17)15/h2-3,6H,4-5H2,1H3,(H-,15,16)/q-1 |
| InChIKey | FEBROFFUWBLDLU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |