C19H19F3N2O — CID 46308540
1-(3-methoxypropyl)-2-(2-methylphenyl)-5-(trifluoromethyl)benzimidazole (PubChem CID 46308540) has the molecular formula C19H19F3N2O and a molecular weight of 348.37 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2-(2-methylphenyl)-5-(trifluoromethyl)benzimidazole.
| Compound Name | 1-(3-methoxypropyl)-2-(2-methylphenyl)-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 46308540 |
| Molecular Formula | C19H19F3N2O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-(3-methoxypropyl)-2-(2-methylphenyl)-5-(trifluoromethyl)benzimidazole |
| SMILES | COCCCn1c(-c2ccccc2C)nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H19F3N2O/c1-13-6-3-4-7-15(13)18-23-16-12-14(19(20,21)22)8-9-17(16)24(18)10-5-11-25-2/h3-4,6-9,12H,5,10-11H2,1-2H3 |
| InChIKey | ONHNANILINATLY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|